CymitQuimica logo

CAS 1105191-50-1

:

2,3-Dihydro-5-(hydroxymethyl)-N-2-propen-1-yl-2-thioxo-1H-imidazole-1-acetamide

Description:
2,3-Dihydro-5-(hydroxymethyl)-N-2-propen-1-yl-2-thioxo-1H-imidazole-1-acetamide is a chemical compound characterized by its unique imidazole ring structure, which incorporates both thioxo and acetamide functional groups. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the imidazole moiety, which is known for its role in various biochemical processes. The hydroxymethyl group contributes to its polarity, potentially enhancing solubility in polar solvents. The presence of the propenyl group suggests that it may participate in various chemical reactions, including polymerization or addition reactions. Additionally, the thioxo group may impart specific reactivity or stability characteristics, influencing its behavior in biological systems or synthetic applications. Overall, this compound's structural features suggest it could be of interest in medicinal chemistry or as a precursor in organic synthesis, although specific applications would depend on further research into its biological activity and reactivity.
Formula:C9H13N3O2S
InChI:InChI=1S/C9H13N3O2S/c1-2-3-10-8(14)5-12-7(6-13)4-11-9(12)15/h2,4,13H,1,3,5-6H2,(H,10,14)(H,11,15)
InChI key:InChIKey=YOIORHXCQIFOTB-UHFFFAOYSA-N
SMILES:C(C(NCC=C)=O)N1C(CO)=CNC1=S
Synonyms:
  • 2,3-Dihydro-5-(hydroxymethyl)-N-2-propen-1-yl-2-thioxo-1H-imidazole-1-acetamide
  • 1H-Imidazole-1-acetamide, 2,3-dihydro-5-(hydroxymethyl)-N-2-propen-1-yl-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.