CymitQuimica logo

CAS 1105191-55-6

:

2,3-Dihydro-5-(hydroxymethyl)-N-(1-methylethyl)-2-thioxo-1H-imidazole-1-acetamide

Description:
2,3-Dihydro-5-(hydroxymethyl)-N-(1-methylethyl)-2-thioxo-1H-imidazole-1-acetamide is a chemical compound characterized by its imidazole ring structure, which is a five-membered heterocyclic compound containing nitrogen atoms. The presence of a thioxo group (a sulfur atom double-bonded to a carbon atom) contributes to its reactivity and potential biological activity. The hydroxymethyl group indicates the presence of a hydroxyl (-OH) functional group attached to a methylene (-CH2-) unit, which can enhance solubility and reactivity. The N-(1-methylethyl) substituent suggests that the compound has an isopropyl group, which may influence its steric properties and interactions with biological targets. This compound may exhibit various pharmacological activities, potentially making it of interest in medicinal chemistry. Its specific properties, such as solubility, stability, and biological activity, would depend on the molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its characteristics and potential applications.
Formula:C9H15N3O2S
InChI:InChI=1S/C9H15N3O2S/c1-6(2)11-8(14)4-12-7(5-13)3-10-9(12)15/h3,6,13H,4-5H2,1-2H3,(H,10,15)(H,11,14)
InChI key:InChIKey=FWURTIKXFIILQE-UHFFFAOYSA-N
SMILES:C(C(NC(C)C)=O)N1C(CO)=CNC1=S
Synonyms:
  • 2,3-Dihydro-5-(hydroxymethyl)-N-(1-methylethyl)-2-thioxo-1H-imidazole-1-acetamide
  • 1H-Imidazole-1-acetamide, 2,3-dihydro-5-(hydroxymethyl)-N-(1-methylethyl)-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.