CAS 1105191-60-3
:N-Cyclopentyl-2,3-dihydro-5-(hydroxymethyl)-2-thioxo-1H-imidazole-1-acetamide
Description:
N-Cyclopentyl-2,3-dihydro-5-(hydroxymethyl)-2-thioxo-1H-imidazole-1-acetamide is a chemical compound characterized by its imidazole core, which features a thioxo group and a hydroxymethyl substituent. The presence of the cyclopentyl group contributes to its hydrophobic characteristics, potentially influencing its solubility and biological activity. This compound may exhibit various pharmacological properties due to its structural features, making it of interest in medicinal chemistry. The thioxo group can enhance reactivity and may play a role in interactions with biological targets. Additionally, the imidazole ring is known for its ability to participate in hydrogen bonding and coordination with metal ions, which can be significant in biological systems. Overall, the unique combination of functional groups in this compound suggests potential applications in drug development or as a biochemical probe, although specific biological activities and mechanisms would require further investigation.
Formula:C11H17N3O2S
InChI:InChI=1S/C11H17N3O2S/c15-7-9-5-12-11(17)14(9)6-10(16)13-8-3-1-2-4-8/h5,8,15H,1-4,6-7H2,(H,12,17)(H,13,16)
InChI key:InChIKey=OXFYVYJXWRJROU-UHFFFAOYSA-N
SMILES:C(C(NC1CCCC1)=O)N2C(CO)=CNC2=S
Synonyms:- N-Cyclopentyl-2,3-dihydro-5-(hydroxymethyl)-2-thioxo-1H-imidazole-1-acetamide
- 1H-Imidazole-1-acetamide, N-cyclopentyl-2,3-dihydro-5-(hydroxymethyl)-2-thioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.