CAS 1105191-61-4: 5,6-Dimethyl-N-(phenylmethyl)-2-benzothiazolamine

Description:5,6-Dimethyl-N-(phenylmethyl)-2-benzothiazolamine is an organic compound characterized by its benzothiazole core, which features a fused benzene and thiazole ring. This compound contains two methyl groups at the 5 and 6 positions of the benzothiazole ring, contributing to its hydrophobic properties. The presence of the N-(phenylmethyl) substituent introduces an aromatic phenyl group, enhancing its potential for interactions in biological systems. The compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic nature, while its amine functional group may allow for hydrogen bonding with polar solvents. As a benzothiazole derivative, it may possess biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of therapeutic agents. However, specific data regarding its toxicity, stability, and reactivity would require further investigation through experimental studies.

Formula:C₁₆H₁₆N₂S

InChI:InChI=1S/C16H16N2S/c1-11-8-14-15(9-12(11)2)19-16(18-14)17-10-13-6-4-3-5-7-13/h3-9H,10H2,1-2H3,(H,17,18)

InChI key:InChIKey=KLFKQFGLIHTGIP-UHFFFAOYSA-N

SMILES:N1=C(SC=2C=C(C(=CC12)C)C)NCC=3C=CC=CC3

Synonyms:
2-Benzothiazolamine, 5,6-dimethyl-N-(phenylmethyl)-
5,6-Dimethyl-N-(phenylmethyl)-2-benzothiazolamine

Found 2 products.

Brand	Product data	Purity	Price range	Estimated delivery
	N-benzyl-5,6-dimethylbenzo[d]thiazol-2-amine REF: 10-F766011CAS: 1105191-61-4	98%	- - -	Discontinued product
	N-Benzyl-5,6-dimethyl-1,3-benzothiazol-2-amine REF: 3D-FUB19161CAS: 1105191-61-4	Min. 95%	- - -	Discontinued product