CymitQuimica logo

CAS 1105191-65-8

:

N-(4-Fluorophenyl)-2,3-dihydro-5-(hydroxymethyl)-2-thioxo-1H-imidazole-1-acetamide

Description:
N-(4-Fluorophenyl)-2,3-dihydro-5-(hydroxymethyl)-2-thioxo-1H-imidazole-1-acetamide is a chemical compound characterized by its imidazole core, which features a thioxo group and a hydroxymethyl substituent. The presence of the 4-fluorophenyl group indicates that it has a fluorine atom attached to a phenyl ring, which can influence its biological activity and lipophilicity. This compound is likely to exhibit properties typical of imidazole derivatives, such as potential antimicrobial or antifungal activity, due to the imidazole ring's ability to interact with biological targets. The thioxo group may contribute to its reactivity and stability, while the hydroxymethyl group can enhance solubility in polar solvents. The specific arrangement of these functional groups suggests that this compound could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, detailed studies would be necessary to fully elucidate its properties, including its solubility, stability, and biological activity.
Formula:C12H12FN3O2S
InChI:InChI=1S/C12H12FN3O2S/c13-8-1-3-9(4-2-8)15-11(18)6-16-10(7-17)5-14-12(16)19/h1-5,17H,6-7H2,(H,14,19)(H,15,18)
InChI key:InChIKey=QJPXWKUQBMDISQ-UHFFFAOYSA-N
SMILES:C(C(NC1=CC=C(F)C=C1)=O)N2C(CO)=CNC2=S
Synonyms:
  • N-(4-Fluorophenyl)-2,3-dihydro-5-(hydroxymethyl)-2-thioxo-1H-imidazole-1-acetamide
  • 1H-Imidazole-1-acetamide, N-(4-fluorophenyl)-2,3-dihydro-5-(hydroxymethyl)-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.