CAS 1105191-79-4

1,3-Dihydro-5-(4-methoxyphenyl)-1-(3-methylphenyl)-2H-imidazole-2-thione

Description:

1,3-Dihydro-5-(4-methoxyphenyl)-1-(3-methylphenyl)-2H-imidazole-2-thione is a heterocyclic compound characterized by its imidazole ring structure, which contains sulfur in the thione form. This compound features a methoxy group and a methyl-substituted phenyl group, contributing to its potential biological activity and solubility properties. The presence of the thione functional group suggests that it may exhibit properties typical of thioketones, such as reactivity towards electrophiles. The compound's molecular structure indicates it may participate in various chemical reactions, including nucleophilic substitutions and coordination with metal ions. Its unique arrangement of substituents may also influence its pharmacological properties, making it a candidate for research in medicinal chemistry. Additionally, the compound's stability, solubility, and reactivity can be influenced by the electronic effects of the methoxy and methyl groups, which may affect its interactions in biological systems. Overall, this compound represents a class of imidazole derivatives that could have applications in drug development and other chemical fields.

Formula: C₁₇H₁₆N₂OS

InChI: InChI=1S/C17H16N2OS/c1-12-4-3-5-14(10-12)19-16(11-18-17(19)21)13-6-8-15(20-2)9-7-13/h3-11H,1-2H3,(H,18,21)

InChI key: InChIKey=JMKBOVVAGGBSQV-UHFFFAOYSA-N

SMILES: S=C1N(C(=CN1)C2=CC=C(OC)C=C2)C3=CC(C)=CC=C3

Synonyms:

• 1,3-Dihydro-5-(4-methoxyphenyl)-1-(3-methylphenyl)-2H-imidazole-2-thione
• 2H-Imidazole-2-thione, 1,3-dihydro-5-(4-methoxyphenyl)-1-(3-methylphenyl)-