CAS 1105191-83-0: 2-[[[(4-Fluorophenyl)amino]carbonyl]amino]-4-thiazolecarboxylic acid
Description:2-[[[(4-Fluorophenyl)amino]carbonyl]amino]-4-thiazolecarboxylic acid is a chemical compound characterized by its complex structure, which includes a thiazole ring, an amino group, and a carboxylic acid functional group. The presence of the 4-fluorophenyl moiety indicates that the compound has a fluorine atom substituted on a phenyl ring, which can influence its biological activity and solubility. The thiazole ring contributes to the compound's potential as a pharmacophore, making it of interest in medicinal chemistry. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding and affect its solubility in various solvents. Additionally, the presence of multiple functional groups suggests that it may engage in various chemical reactions, making it a candidate for further research in drug development or as a biochemical probe. Its specific properties, such as melting point, solubility, and reactivity, would need to be determined through experimental methods.
Formula:C11H8FN3O3S
InChI:InChI=1S/C11H8FN3O3S/c12-6-1-3-7(4-2-6)13-10(18)15-11-14-8(5-19-11)9(16)17/h1-5H,(H,16,17)(H2,13,14,15,18)
InChI key:InChIKey=ZQZWYMGFPMPJKF-UHFFFAOYSA-N
SMILES:O=C(O)C=1N=C(SC1)NC(=O)NC2=CC=C(F)C=C2
- Synonyms:
- 2-[[[(4-Fluorophenyl)amino]carbonyl]amino]-4-thiazolecarboxylic acid
- 4-Thiazolecarboxylic acid, 2-[[[(4-fluorophenyl)amino]carbonyl]amino]-
Brand | Product data | Purity | Price range | Estimated delivery |
---|---|---|---|---|
![]() | 2-({[(4-fluorophenyl)amino]carbonyl}amino)-1,3-thiazole-4-carboxylic acid REF: 10-F495772CAS: 1105191-83-0 | 95.0% | To inquire | Mon 07 Apr 25 |
![]() | 2-({[(4-Fluorophenyl)amino]carbonyl}amino)-1,3-thiazole-4-carboxylic acid REF: 3D-FUB19183CAS: 1105191-83-0 | Min. 95% | - - - | Discontinued product |

2-({[(4-fluorophenyl)amino]carbonyl}amino)-1,3-thiazole-4-carboxylic acid
Ref: 10-F495772
250mg | To inquire | ||
500mg | To inquire |

2-({[(4-Fluorophenyl)amino]carbonyl}amino)-1,3-thiazole-4-carboxylic acid
Ref: 3D-FUB19183
1g | Discontinued | Request information | |
10mg | Discontinued | Request information | |
50mg | Discontinued | Request information | |
100mg | Discontinued | Request information | |
250mg | Discontinued | Request information | |
500mg | Discontinued | Request information |