CAS 1105191-83-0: 2-[[[(4-Fluorophenyl)amino]carbonyl]amino]-4-thiazolecarboxylic acid

Description: 2-[[[(4-Fluorophenyl)amino]carbonyl]amino]-4-thiazolecarboxylic acid is a chemical compound characterized by its complex structure, which includes a thiazole ring, an amino group, and a carboxylic acid functional group. The presence of the 4-fluorophenyl moiety indicates that the compound has a fluorine atom substituted on a phenyl ring, which can influence its biological activity and solubility. The thiazole ring contributes to the compound's potential as a pharmacophore, making it of interest in medicinal chemistry. This compound is likely to exhibit polar characteristics due to the carboxylic acid group, which can participate in hydrogen bonding and affect its solubility in various solvents. Additionally, the presence of multiple functional groups suggests that it may engage in various chemical reactions, making it a candidate for further research in drug development or as a biochemical probe. Its specific properties, such as melting point, solubility, and reactivity, would need to be determined through experimental methods.

Formula: C₁₁H₈FN₃O₃S

InChI: InChI=1S/C11H8FN3O3S/c12-6-1-3-7(4-2-6)13-10(18)15-11-14-8(5-19-11)9(16)17/h1-5H,(H,16,17)(H2,13,14,15,18)

InChI key: InChIKey=ZQZWYMGFPMPJKF-UHFFFAOYSA-N

SMILES: O=C(O)C=1N=C(SC1)NC(=O)NC2=CC=C(F)C=C2

Synonyms:

• 2-[[[(4-Fluorophenyl)amino]carbonyl]amino]-4-thiazolecarboxylic acid
• 4-Thiazolecarboxylic acid, 2-[[[(4-fluorophenyl)amino]carbonyl]amino]-

2-({[(4-fluorophenyl)amino]carbonyl}amino)-1,3-thiazole-4-carboxylic acid

CAS: 1105191-83-0

• Purity: 95.0%
• Molecular weight: 281.260009765625

2-({[(4-Fluorophenyl)amino]carbonyl}amino)-1,3-thiazole-4-carboxylic acid

CAS: 1105191-83-0

Versatile small molecule scaffold

• Formula: C₁₁H₈FN₃O₃S
• Purity: Min. 95%
• Molecular weight: 281.27 g/mol