CymitQuimica logo

CAS 1105191-88-5

:

1,2,3,6-Tetrahydro-6-oxo-N-(2-thienylmethyl)-2-thioxo-4-pyrimidineacetamide

Description:
1,2,3,6-Tetrahydro-6-oxo-N-(2-thienylmethyl)-2-thioxo-4-pyrimidineacetamide is a chemical compound characterized by its complex structure, which includes a pyrimidine ring fused with a tetrahydro moiety and functional groups such as a thienylmethyl substituent and a thioxo group. This compound is likely to exhibit properties typical of heterocyclic compounds, including potential biological activity due to the presence of the thienyl group, which can enhance lipophilicity and facilitate interactions with biological targets. The thioxo group may contribute to its reactivity and potential as a pharmacophore in medicinal chemistry. Additionally, the presence of the acetamide functional group suggests possible hydrogen bonding capabilities, which can influence solubility and binding interactions. Overall, this compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, although specific biological activities and applications would require further investigation and characterization.
Formula:C11H11N3O2S2
InChI:InChI=1S/C11H11N3O2S2/c15-9(12-6-8-2-1-3-18-8)4-7-5-10(16)14-11(17)13-7/h1-3,5H,4,6H2,(H,12,15)(H2,13,14,16,17)
InChI key:InChIKey=OIIXFSUXVCGYPZ-UHFFFAOYSA-N
SMILES:C(C(NCC1=CC=CS1)=O)C2=CC(=O)NC(=S)N2
Synonyms:
  • 1,2,3,6-Tetrahydro-6-oxo-N-(2-thienylmethyl)-2-thioxo-4-pyrimidineacetamide
  • 4-Pyrimidineacetamide, 1,2,3,6-tetrahydro-6-oxo-N-(2-thienylmethyl)-2-thioxo-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.