CAS 1105191-93-2

2-Chloro-3-methyl-1,7-naphthyridine

Description:

2-Chloro-3-methyl-1,7-naphthyridine is a heterocyclic organic compound characterized by a fused bicyclic structure that includes a naphthyridine moiety. This compound features a chlorine atom at the second position and a methyl group at the third position of the naphthyridine ring system. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of the chlorine atom contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The methyl group can influence the compound's electronic properties and steric hindrance, affecting its reactivity and interactions with biological targets. 2-Chloro-3-methyl-1,7-naphthyridine may be of interest in medicinal chemistry and drug development due to its structural features, which can be modified to enhance biological activity or selectivity. As with many heterocycles, it may also exhibit interesting photophysical properties, making it relevant in materials science and organic electronics.

Formula: C₉H₇ClN₂

InChI: InChI=1S/C9H7ClN2/c1-6-4-7-2-3-11-5-8(7)12-9(6)10/h2-5H,1H3

InChI key: InChIKey=YMXGPPWLIZUHJK-UHFFFAOYSA-N

SMILES: CC1=CC2=C(N=C1Cl)C=NC=C2

Synonyms:

• 1,7-Naphthyridine, 2-chloro-3-methyl-
• 2-Chloro-3-methyl-1,7-naphthyridine