CAS 1105192-05-9

2-[[(1,2-Dihydro-2-oxo-3-pyridinyl)carbonyl]amino]-4-thiazolepropanoic acid

Description:

2-[[(1,2-Dihydro-2-oxo-3-pyridinyl)carbonyl]amino]-4-thiazolepropanoic acid, identified by its CAS number 1105192-05-9, is a chemical compound characterized by its complex structure that includes a thiazole ring and a pyridine moiety. This compound features a carboxylic acid functional group, which contributes to its acidic properties, and an amide linkage that connects the thiazole and pyridine components. The presence of the thiazole ring suggests potential biological activity, as thiazoles are often found in pharmaceuticals and agrochemicals. The compound may exhibit solubility in polar solvents due to the carboxylic acid group, while its molecular structure may influence its reactivity and interaction with biological targets. Additionally, the presence of the carbonyl and amino groups indicates potential for hydrogen bonding, which can affect its stability and solubility. Overall, this compound's unique structural features may contribute to its potential applications in medicinal chemistry or as a biochemical probe.

Formula: C₁₂H₁₁N₃O₄S

InChI: InChI=1S/C12H11N3O4S/c16-9(17)4-3-7-6-20-12(14-7)15-11(19)8-2-1-5-13-10(8)18/h1-2,5-6H,3-4H2,(H,13,18)(H,16,17)(H,14,15,19)

InChI key: InChIKey=ISSHWVBFQGHJAE-UHFFFAOYSA-N

SMILES: C(NC1=NC(CCC(O)=O)=CS1)(=O)C=2C(=O)NC=CC2

Synonyms:

• 4-Thiazolepropanoic acid, 2-[[(1,2-dihydro-2-oxo-3-pyridinyl)carbonyl]amino]-
• 2-[[(1,2-Dihydro-2-oxo-3-pyridinyl)carbonyl]amino]-4-thiazolepropanoic acid