CAS 1105192-07-1

4-Oxopyrido[2,3-d]pyrimidine-3(4H)-acetic acid

Description:

4-Oxopyrido[2,3-d]pyrimidine-3(4H)-acetic acid is a heterocyclic compound characterized by its fused pyridine and pyrimidine rings, which contribute to its unique chemical properties. This compound features a ketone functional group and a carboxylic acid group, indicating potential for both nucleophilic and electrophilic reactivity. The presence of the pyridine ring enhances its aromatic stability and may influence its solubility and interaction with biological systems. Typically, such compounds exhibit moderate to high polarity due to the carboxylic acid group, which can participate in hydrogen bonding. The structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as heterocycles are often integral to drug design. Additionally, the compound may exhibit biological activity, making it of interest for further research in pharmacology and biochemistry. Its specific reactivity and interactions would depend on the surrounding environment and the presence of other functional groups. Overall, 4-Oxopyrido[2,3-d]pyrimidine-3(4H)-acetic acid represents a versatile scaffold for further chemical exploration.

Formula: C₉H₇N₃O₃

InChI: InChI=1S/C9H7N3O3/c13-7(14)4-12-5-11-8-6(9(12)15)2-1-3-10-8/h1-3,5H,4H2,(H,13,14)

InChI key: InChIKey=LAJVSGQTTAHCHH-UHFFFAOYSA-N

SMILES: O=C1C=2C(N=CN1CC(O)=O)=NC=CC2

Synonyms:

• (4-Oxo-4H-pyrido[2,3-d]pyrimidin-3-yl)-acetic acid
• 2-[4-Oxo-3H,4H-pyrido[2,3-d]pyrimidin-3-yl]acetic acid
• 2-(4-Oxopyrido[2,3-d]pyrimidin-3(4H)-yl)acetic acid
• 4-Oxopyrido[2,3-d]pyrimidine-3(4H)-acetic acid
• Pyrido[2,3-d]pyrimidine-3(4H)-acetic acid, 4-oxo-