
CAS 1105192-16-2
:3-([1,1′-Biphenyl]-4-ylmethyl)-2-thioxo-4-thiazolidinone
Description:
3-([1,1′-Biphenyl]-4-ylmethyl)-2-thioxo-4-thiazolidinone is a thiazolidinone derivative characterized by the presence of a thiazolidine ring, which incorporates a thione functional group (thioxo) and a biphenyl moiety. This compound typically exhibits a range of biological activities, making it of interest in medicinal chemistry. The thiazolidinone structure is known for its potential in drug development, particularly in the context of anti-inflammatory and antimicrobial properties. The biphenyl substituent can influence the compound's lipophilicity and biological interactions, potentially enhancing its pharmacological profile. Additionally, the thioxo group may contribute to the reactivity and stability of the molecule. Overall, this compound's unique structural features suggest it may have applications in various fields, including pharmaceuticals and agrochemicals, although specific biological activities and mechanisms would require further investigation through empirical studies.
Formula:C16H13NOS2
InChI:InChI=1S/C16H13NOS2/c18-15-11-20-16(19)17(15)10-12-6-8-14(9-7-12)13-4-2-1-3-5-13/h1-9H,10-11H2
InChI key:InChIKey=JHBKQXCEQNGHDK-UHFFFAOYSA-N
SMILES:C(C1=CC=C(C=C1)C2=CC=CC=C2)N3C(=O)CSC3=S
Synonyms:- 4-Thiazolidinone, 3-([1,1′-biphenyl]-4-ylmethyl)-2-thioxo-
- 3-([1,1′-Biphenyl]-4-ylmethyl)-2-thioxo-4-thiazolidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.