CAS 1105192-22-0

3-[2-(4-Pyridinyl)ethyl]-2-thioxo-4-thiazolidinone

Description:

3-[2-(4-Pyridinyl)ethyl]-2-thioxo-4-thiazolidinone is a chemical compound characterized by its thiazolidinone core structure, which features a thiazolidine ring containing sulfur and nitrogen atoms. The presence of a pyridine ring in its structure contributes to its potential biological activity, as pyridine derivatives are often associated with various pharmacological properties. This compound typically exhibits a thioxo group, which can influence its reactivity and stability. The thiazolidinone framework is known for its role in medicinal chemistry, particularly in the development of anti-inflammatory and antimicrobial agents. Additionally, the compound's solubility, melting point, and other physical properties can vary based on its specific formulation and purity. Its CAS number, 1105192-22-0, allows for precise identification in chemical databases, facilitating research and application in various fields, including pharmaceuticals and organic synthesis. Overall, this compound represents a class of heterocyclic compounds with significant potential for further exploration in drug development and other chemical applications.

Formula: C₁₀H₁₀N₂OS₂

InChI: InChI=1S/C10H10N2OS2/c13-9-7-15-10(14)12(9)6-3-8-1-4-11-5-2-8/h1-2,4-5H,3,6-7H2

InChI key: InChIKey=GZDMOZZJDFUYIH-UHFFFAOYSA-N

SMILES: C(CC=1C=CN=CC1)N2C(=O)CSC2=S

Synonyms:

• 4-Thiazolidinone, 3-[2-(4-pyridinyl)ethyl]-2-thioxo-
• 3-[2-(4-Pyridinyl)ethyl]-2-thioxo-4-thiazolidinone