CAS 1105192-27-5

2-[(2-Pyridinylcarbonyl)amino]-4-thiazolecarboxylic acid

Description:

2-[(2-Pyridinylcarbonyl)amino]-4-thiazolecarboxylic acid is a chemical compound characterized by its unique structural features, which include a thiazole ring and a pyridine moiety. This compound typically exhibits properties associated with both heterocyclic and carboxylic acid functionalities, making it potentially useful in various chemical applications, including medicinal chemistry. The presence of the thiazole ring contributes to its biological activity, as thiazoles are known for their roles in pharmacology. The carboxylic acid group can participate in hydrogen bonding and may influence solubility and reactivity. Additionally, the pyridine ring can engage in π-π stacking interactions and may enhance the compound's ability to interact with biological targets. Overall, this compound's characteristics suggest it may have potential applications in drug development or as a biochemical probe, although specific biological activities would require further investigation. Its CAS number, 1105192-27-5, allows for precise identification in chemical databases and literature.

Formula: C₁₀H₇N₃O₃S

InChI: InChI=1S/C10H7N3O3S/c14-8(6-3-1-2-4-11-6)13-10-12-7(5-17-10)9(15)16/h1-5H,(H,15,16)(H,12,13,14)

InChI key: InChIKey=BIUUYPCBHJBWJB-UHFFFAOYSA-N

SMILES: N(C(=O)C1=CC=CC=N1)C2=NC(C(O)=O)=CS2

Synonyms:

• 2-[(2-Pyridinylcarbonyl)amino]-4-thiazolecarboxylic acid
• 4-Thiazolecarboxylic acid, 2-[(2-pyridinylcarbonyl)amino]-