CAS 1105192-41-3
:2-(3,5-Dimethylphenyl)-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-amine
Description:
2-(3,5-Dimethylphenyl)-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-amine is a chemical compound characterized by its unique structure, which includes a thieno[3,4-c]pyrazole core fused with a 3,5-dimethylphenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its ability to interact with various biological targets. The presence of the thieno and pyrazole moieties suggests that it may possess interesting pharmacological properties, potentially acting as an inhibitor or modulator in various biochemical pathways. Its molecular structure contributes to its solubility and stability, which are important for its application in medicinal chemistry. Additionally, the presence of the amine functional group may enhance its reactivity and ability to form hydrogen bonds, influencing its interactions in biological systems. Overall, this compound represents a class of heterocycles that are of significant interest in drug discovery and development.
Formula:C13H15N3S
InChI:InChI=1S/C13H15N3S/c1-8-3-9(2)5-10(4-8)16-13(14)11-6-17-7-12(11)15-16/h3-5H,6-7,14H2,1-2H3
InChI key:InChIKey=ANMMCTBQGGRPJE-UHFFFAOYSA-N
SMILES:NC=1N(N=C2C1CSC2)C3=CC(C)=CC(C)=C3
Synonyms:- 2-(3,5-Dimethylphenyl)-2,6-dihydro-4H-thieno[3,4-c]pyrazol-3-amine
- 4H-Thieno[3,4-c]pyrazol-3-amine, 2-(3,5-dimethylphenyl)-2,6-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.