CymitQuimica logo

CAS 1105192-55-9

:

2-(Pyrido[2,3-d]pyrimidin-4-ylthio)acetic acid

Description:
2-(Pyrido[2,3-d]pyrimidin-4-ylthio)acetic acid is a chemical compound characterized by its unique structure, which includes a pyrido[2,3-d]pyrimidine moiety linked to a thioacetic acid group. This compound typically exhibits properties associated with both heterocyclic compounds and thiol derivatives, which may influence its reactivity and biological activity. It is likely to be a solid at room temperature, with potential solubility in polar solvents due to the presence of the carboxylic acid functional group. The compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its specific interactions and mechanisms of action would depend on the functional groups present and their spatial arrangement. Additionally, the presence of sulfur in the thioacetic acid portion may contribute to its chemical reactivity, potentially allowing for further derivatization or interaction with biological targets. As with any chemical substance, safety data and handling precautions should be considered when working with this compound.
Formula:C9H7N3O2S
InChI:InChI=1S/C9H7N3O2S/c13-7(14)4-15-9-6-2-1-3-10-8(6)11-5-12-9/h1-3,5H,4H2,(H,13,14)
InChI key:InChIKey=XMDPQSNDCYOIQO-UHFFFAOYSA-N
SMILES:S(CC(O)=O)C=1C2=C(N=CN1)N=CC=C2
Synonyms:
  • Acetic acid, 2-(pyrido[2,3-d]pyrimidin-4-ylthio)-
  • 2-(Pyrido[2,3-d]pyrimidin-4-ylthio)acetic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.