CAS 1105192-76-4

3-(4-Fluorophenyl)-4-methylisoxazolo[5,4-b]pyridine-6-carboxylic acid

Description:

3-(4-Fluorophenyl)-4-methylisoxazolo[5,4-b]pyridine-6-carboxylic acid is a chemical compound characterized by its unique isoxazole and pyridine ring structures, which contribute to its potential biological activity. The presence of a fluorophenyl group enhances its lipophilicity and may influence its interaction with biological targets. This compound features a carboxylic acid functional group, which can participate in hydrogen bonding and may affect its solubility and reactivity. The isoxazole moiety is known for its role in various pharmacological activities, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in areas targeting neurological or inflammatory conditions. Additionally, the specific arrangement of substituents can impact its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion (ADME). Overall, the characteristics of this compound make it a subject of interest for further research in the field of organic and medicinal chemistry.

Formula: C₁₄H₉FN₂O₃

InChI: InChI=1S/C14H9FN2O3/c1-7-6-10(14(18)19)16-13-11(7)12(17-20-13)8-2-4-9(15)5-3-8/h2-6H,1H3,(H,18,19)

InChI key: InChIKey=QBMACEIMXCIKDY-UHFFFAOYSA-N

SMILES: CC1=C2C(=NOC2=NC(C(O)=O)=C1)C3=CC=C(F)C=C3

Synonyms:

• Isoxazolo[5,4-b]pyridine-6-carboxylic acid, 3-(4-fluorophenyl)-4-methyl-
• 3-(4-Fluorophenyl)-4-methylisoxazolo[5,4-b]pyridine-6-carboxylic acid