CAS 1105192-94-6
:1-(2,6-Dimethyl-4-morpholinyl)-2-(1H-indol-1-yl)ethanone
Description:
1-(2,6-Dimethyl-4-morpholinyl)-2-(1H-indol-1-yl)ethanone, identified by its CAS number 1105192-94-6, is a synthetic organic compound characterized by its complex structure, which includes an indole moiety and a morpholine ring. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential biological activity. The presence of the morpholine group suggests possible interactions with biological targets, making it of interest in medicinal chemistry. The dimethyl substitution on the aromatic ring can influence its lipophilicity and solubility, affecting its pharmacokinetic properties. Additionally, the ketone functional group may participate in various chemical reactions, including nucleophilic attacks and condensation reactions. Overall, this compound's unique structural features may confer specific reactivity and biological properties, warranting further investigation for potential applications in drug development or other chemical syntheses.
Formula:C16H20N2O2
InChI:InChI=1S/C16H20N2O2/c1-12-9-18(10-13(2)20-12)16(19)11-17-8-7-14-5-3-4-6-15(14)17/h3-8,12-13H,9-11H2,1-2H3
InChI key:InChIKey=SFZGGZKCILZCNJ-UHFFFAOYSA-N
SMILES:C(C(=O)N1CC(C)OC(C)C1)N2C=3C(C=C2)=CC=CC3
Synonyms:- 1-(2,6-Dimethyl-4-morpholinyl)-2-(1H-indol-1-yl)ethanone
- Ethanone, 1-(2,6-dimethyl-4-morpholinyl)-2-(1H-indol-1-yl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.