CymitQuimica logo

CAS 1105193-01-8

:

Ethyl 1,6-dihydro-4-hydroxy-1-(2-methylphenyl)-6-oxo-3-pyridazinecarboxylate

Description:
Ethyl 1,6-dihydro-4-hydroxy-1-(2-methylphenyl)-6-oxo-3-pyridazinecarboxylate is a chemical compound characterized by its complex structure, which includes a pyridazine ring, a carboxylate group, and an ethyl ester functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, such as potential biological activity and solubility in organic solvents. The presence of the hydroxyl group suggests it may participate in hydrogen bonding, influencing its reactivity and interaction with other molecules. The 2-methylphenyl substituent can contribute to its lipophilicity, potentially affecting its pharmacokinetic properties if considered for medicinal applications. Additionally, the compound may exhibit specific spectral characteristics in techniques like NMR and IR spectroscopy, aiding in its identification and characterization. Overall, the unique combination of functional groups and structural features makes this compound of interest in various fields, including pharmaceuticals and organic synthesis.
Formula:C14H14N2O4
InChI:InChI=1S/C14H14N2O4/c1-3-20-14(19)13-11(17)8-12(18)16(15-13)10-7-5-4-6-9(10)2/h4-8,17H,3H2,1-2H3
InChI key:InChIKey=PJPJBQPXTNKBOC-UHFFFAOYSA-N
SMILES:O=C1N(N=C(C(OCC)=O)C(O)=C1)C2=C(C)C=CC=C2
Synonyms:
  • Ethyl 1,6-dihydro-4-hydroxy-1-(2-methylphenyl)-6-oxo-3-pyridazinecarboxylate
  • 3-Pyridazinecarboxylic acid, 1,6-dihydro-4-hydroxy-1-(2-methylphenyl)-6-oxo-, ethyl ester
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.