CymitQuimica logo

CAS 1105193-42-7

:

2-[2-(2-Chloro-6,7-dimethyl-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione

Description:
2-[2-(2-Chloro-6,7-dimethyl-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione, identified by its CAS number 1105193-42-7, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline moiety and an isoindole dione framework. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the chloro and dimethyl groups suggests that it may have specific interactions with biological targets, potentially influencing its pharmacological profile. Its structural features may contribute to its stability and reactivity, which are important for its applications in drug development. Additionally, the compound's unique arrangement of functional groups may allow for various synthetic modifications, enhancing its utility in research and therapeutic contexts. As with many compounds in this category, safety and handling precautions are essential due to potential toxicity or reactivity.
Formula:C21H17ClN2O2
InChI:InChI=1S/C21H17ClN2O2/c1-12-9-15-11-14(19(22)23-18(15)10-13(12)2)7-8-24-20(25)16-5-3-4-6-17(16)21(24)26/h3-6,9-11H,7-8H2,1-2H3
InChI key:InChIKey=FQPDYIFTKHMDFE-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCC3=CC4=C(N=C3Cl)C=C(C)C(C)=C4)=CC=CC2
Synonyms:
  • 1H-Isoindole-1,3(2H)-dione, 2-[2-(2-chloro-6,7-dimethyl-3-quinolinyl)ethyl]-
  • 2-[2-(2-Chloro-6,7-dimethyl-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.