CAS 1105193-51-8

2-[2-(2-Chloro-6,7-dimethoxy-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione

Description:

The chemical substance known as 2-[2-(2-Chloro-6,7-dimethoxy-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 1105193-51-8, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline moiety and an isoindole dione framework. This compound features a chloro substituent and methoxy groups that contribute to its unique chemical properties and potential biological activity. It is likely to exhibit specific interactions with biological targets due to its structural features, making it of interest in medicinal chemistry and pharmacology. The presence of the isoindole and quinoline rings suggests potential applications in drug development, particularly in areas related to cancer or neurological disorders. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, which may affect its behavior in various chemical environments. Overall, this substance represents a class of compounds that may hold promise for therapeutic applications, warranting further investigation into its properties and effects.

Formula: C₂₁H₁₇ClN₂O₄

InChI: InChI=1S/C21H17ClN2O4/c1-27-17-10-13-9-12(19(22)23-16(13)11-18(17)28-2)7-8-24-20(25)14-5-3-4-6-15(14)21(24)26/h3-6,9-11H,7-8H2,1-2H3

InChI key: InChIKey=GTZICGUCZASSGZ-UHFFFAOYSA-N

SMILES: C(CN1C(=O)C=2C(C1=O)=CC=CC2)C3=CC4=C(C=C(OC)C(OC)=C4)N=C3Cl

Synonyms:

• 1H-Isoindole-1,3(2H)-dione, 2-[2-(2-chloro-6,7-dimethoxy-3-quinolinyl)ethyl]-
• 2-[2-(2-Chloro-6,7-dimethoxy-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione