CAS 1105193-56-3
:2-[2-(2-Chloro-5,8-dimethoxy-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione
Description:
The chemical substance known as 2-[2-(2-Chloro-5,8-dimethoxy-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 1105193-56-3, is a synthetic organic compound characterized by its complex molecular structure, which includes a quinoline moiety and an isoindole dione framework. This compound features a chloro substituent and two methoxy groups, contributing to its unique chemical properties and potential biological activity. The presence of these functional groups may influence its solubility, reactivity, and interaction with biological targets. Typically, compounds of this nature are investigated for their pharmacological properties, including potential anti-cancer or anti-inflammatory activities. The specific stereochemistry and electronic properties of the molecule can also play a significant role in its behavior in various chemical environments. As with many synthetic organic compounds, understanding its characteristics requires consideration of its molecular interactions, stability, and potential applications in medicinal chemistry or material science.
Formula:C21H17ClN2O4
InChI:InChI=1S/C21H17ClN2O4/c1-27-16-7-8-17(28-2)18-15(16)11-12(19(22)23-18)9-10-24-20(25)13-5-3-4-6-14(13)21(24)26/h3-8,11H,9-10H2,1-2H3
InChI key:InChIKey=AMRWWCOJSFCHKD-UHFFFAOYSA-N
SMILES:O(C)C=1C2=C(C(OC)=CC1)N=C(Cl)C(CCN3C(=O)C=4C(C3=O)=CC=CC4)=C2
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2-[2-(2-chloro-5,8-dimethoxy-3-quinolinyl)ethyl]-
- 2-[2-(2-Chloro-5,8-dimethoxy-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.