CAS 1105193-60-9

4-(1-Methylethyl)-6-oxo-1(6H)-pyrimidineacetic acid

Description:

4-(1-Methylethyl)-6-oxo-1(6H)-pyrimidineacetic acid, identified by its CAS number 1105193-60-9, is a chemical compound that belongs to the class of pyrimidine derivatives. This substance features a pyrimidine ring, which is a six-membered aromatic ring containing two nitrogen atoms at positions 1 and 3. The presence of a ketone group at the 6-position contributes to its reactivity and potential biological activity. The acetic acid moiety indicates that it possesses acidic properties, which may influence its solubility and interaction with biological systems. The isopropyl group (1-methylethyl) at the 4-position enhances its lipophilicity, potentially affecting its pharmacokinetic properties. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. However, specific applications, safety profiles, and detailed physicochemical properties would require further investigation and analysis in the context of its intended use.

Formula: C₉H₁₂N₂O₃

InChI: InChI=1S/C9H12N2O3/c1-6(2)7-3-8(12)11(5-10-7)4-9(13)14/h3,5-6H,4H2,1-2H3,(H,13,14)

InChI key: InChIKey=RQQSJBPHOUPLRF-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C(=O)C=C(C(C)C)N=C1

Synonyms:

• 4-(1-Methylethyl)-6-oxo-1(6H)-pyrimidineacetic acid
• 1(6H)-Pyrimidineacetic acid, 4-(1-methylethyl)-6-oxo-