CAS 1105193-61-0
:2-[2-(2-Chloro-7-methyl-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione
Description:
2-[2-(2-Chloro-7-methyl-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione, with the CAS number 1105193-61-0, is a synthetic organic compound characterized by its complex molecular structure, which includes both isoindole and quinoline moieties. This compound typically exhibits properties associated with heterocyclic compounds, such as potential biological activity due to the presence of nitrogen-containing rings. The chloro and methyl substituents on the quinoline ring can influence its reactivity and solubility, potentially enhancing its pharmacological properties. Isoindole derivatives are known for their diverse biological activities, including anti-cancer and anti-inflammatory effects. The compound's specific interactions and mechanisms of action would depend on its molecular conformation and the functional groups present. Additionally, its stability, solubility, and reactivity can vary based on environmental conditions such as pH and temperature. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug development.
Formula:C20H15ClN2O2
InChI:InChI=1S/C20H15ClN2O2/c1-12-6-7-13-11-14(18(21)22-17(13)10-12)8-9-23-19(24)15-4-2-3-5-16(15)20(23)25/h2-7,10-11H,8-9H2,1H3
InChI key:InChIKey=PSIUAVCYCJNOMH-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(=O)N1CCC3=CC4=C(N=C3Cl)C=C(C)C=C4)=CC=CC2
Synonyms:- 1H-Isoindole-1,3(2H)-dione, 2-[2-(2-chloro-7-methyl-3-quinolinyl)ethyl]-
- 2-[2-(2-Chloro-7-methyl-3-quinolinyl)ethyl]-1H-isoindole-1,3(2H)-dione
- 2-[2-(2-Chloro-7-methylquinolin-3-yl)ethyl]isoindole-1,3-dione
- 2-[2-(2-Chloro-7-methylquinolin-3-yl)ethyl]-2,3-dihydro-1H-isoindole-1,3-dione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.