CymitQuimica logo

CAS 1105193-81-4

:

4-Amino-1-(2-thienylmethyl)-2-pyrrolidinone

Description:
4-Amino-1-(2-thienylmethyl)-2-pyrrolidinone is a chemical compound characterized by its unique structure, which includes a pyrrolidinone ring and a thienylmethyl substituent. This compound features an amino group that contributes to its potential reactivity and biological activity. The presence of the thienyl group, a five-membered aromatic ring containing sulfur, may impart specific electronic properties and influence the compound's interactions with biological targets. Typically, such compounds are investigated for their pharmacological properties, including potential applications in medicinal chemistry. The molecular structure suggests that it may exhibit polar characteristics due to the amino and carbonyl functionalities, which could affect its solubility and bioavailability. Additionally, the compound's stereochemistry could play a significant role in its biological activity, making it a subject of interest for further research in drug development and synthesis. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings.
Formula:C9H12N2OS
InChI:InChI=1S/C9H12N2OS/c10-7-4-9(12)11(5-7)6-8-2-1-3-13-8/h1-3,7H,4-6,10H2
InChI key:InChIKey=JMIWBNCKYHZWSA-UHFFFAOYSA-N
SMILES:C(N1CC(N)CC1=O)C2=CC=CS2
Synonyms:
  • 4-Amino-1-(2-thienylmethyl)-2-pyrrolidinone
  • 2-Pyrrolidinone, 4-amino-1-(2-thienylmethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.