CymitQuimica logo

CAS 1105193-90-5

:

6-(9H-Fluoren-2-yl)-3(2H)-pyridazinone

Description:
6-(9H-Fluoren-2-yl)-3(2H)-pyridazinone, identified by its CAS number 1105193-90-5, is a chemical compound characterized by its unique structural features, which include a fluorenyl group and a pyridazinone moiety. This compound typically exhibits a solid-state form and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its bioactive properties. The presence of the fluorenyl group contributes to its aromatic characteristics, which can influence its electronic properties and reactivity. Additionally, the pyridazinone structure may impart specific biological activities, making it a subject of interest in drug discovery. The compound's solubility, stability, and reactivity can vary based on the solvent and environmental conditions, which are crucial for its practical applications. Overall, 6-(9H-Fluoren-2-yl)-3(2H)-pyridazinone represents a versatile scaffold in organic synthesis and medicinal chemistry, warranting further investigation into its properties and potential uses.
Formula:C17H12N2O
InChI:InChI=1S/C17H12N2O/c20-17-8-7-16(18-19-17)12-5-6-15-13(10-12)9-11-3-1-2-4-14(11)15/h1-8,10H,9H2,(H,19,20)
InChI key:InChIKey=KWSFVBZNHJZKHV-UHFFFAOYSA-N
SMILES:O=C1C=CC(C=2C=C3C(C=4C(C3)=CC=CC4)=CC2)=NN1
Synonyms:
  • 3(2H)-Pyridazinone, 6-(9H-fluoren-2-yl)-
  • 6-(9H-Fluoren-2-yl)-3(2H)-pyridazinone
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.