CAS 1105194-05-5
:6-[4-(1-Piperidinyl)phenyl]-3(2H)-pyridazinone
Description:
6-[4-(1-Piperidinyl)phenyl]-3(2H)-pyridazinone, identified by its CAS number 1105194-05-5, is a chemical compound characterized by its unique molecular structure, which includes a pyridazinone core substituted with a piperidinyl-phenyl group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the piperidine moiety, which is known for its role in various pharmacological applications. The pyridazinone structure may contribute to its stability and reactivity, making it of interest in medicinal chemistry. Additionally, the compound's solubility, melting point, and other physical properties would depend on its specific molecular interactions and the presence of functional groups. Its potential applications could span various fields, including drug development and synthesis of novel therapeutic agents. However, detailed studies would be necessary to fully elucidate its characteristics, including its reactivity, biological activity, and safety profile.
Formula:C15H17N3O
InChI:InChI=1S/C15H17N3O/c19-15-9-8-14(16-17-15)12-4-6-13(7-5-12)18-10-2-1-3-11-18/h4-9H,1-3,10-11H2,(H,17,19)
InChI key:InChIKey=NYLVWWSDCCXALW-UHFFFAOYSA-N
SMILES:O=C1C=CC(C2=CC=C(C=C2)N3CCCCC3)=NN1
Synonyms:- 3(2H)-Pyridazinone, 6-[4-(1-piperidinyl)phenyl]-
- 6-[4-(1-Piperidinyl)phenyl]-3(2H)-pyridazinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.