CAS 1105194-09-9

5-[3-[(1-Methylethyl)sulfonyl]phenyl]-1,3,4-oxadiazol-2-amine

Description:

5-[3-[(1-Methylethyl)sulfonyl]phenyl]-1,3,4-oxadiazol-2-amine is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of a sulfonyl group attached to a phenyl ring enhances its solubility and reactivity, making it of interest in medicinal chemistry. This compound typically exhibits properties such as moderate to high stability under standard conditions, and it may possess specific pharmacological activities, which could include anti-inflammatory or antimicrobial effects, although detailed biological data would be necessary to confirm these activities. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in drug development. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including purification methods such as crystallization or chromatography. Safety data and handling precautions should be observed, as with any chemical substance, particularly in laboratory settings.

Formula: C₁₁H₁₃N₃O₃S

InChI: InChI=1S/C11H13N3O3S/c1-7(2)18(15,16)9-5-3-4-8(6-9)10-13-14-11(12)17-10/h3-7H,1-2H3,(H2,12,14)

InChI key: InChIKey=UAPTZXKQMSODOB-UHFFFAOYSA-N

SMILES: S(C(C)C)(=O)(=O)C=1C=C(C=CC1)C=2OC(N)=NN2

Synonyms:

• 1,3,4-Oxadiazol-2-amine, 5-[3-[(1-methylethyl)sulfonyl]phenyl]-
• 5-[3-[(1-Methylethyl)sulfonyl]phenyl]-1,3,4-oxadiazol-2-amine
• 5-[3-(Isopropylsulfonyl)phenyl]-1,3,4-oxadiazol-2-amine

5-[3-(isopropylsulfonyl)phenyl]-1,3,4-oxadiazol-2-amine

CAS: 1105194-09-9

Formula: C₁₁H₁₃N₃O₃S

Purity: 95.0%

Molecular weight: 267.3

Ref: 10-F496054