CAS 1105194-10-2

3(2H)-Pyridazinone, 6-[4-(4-morpholinyl)phenyl]-

Description:

3(2H)-Pyridazinone, 6-[4-(4-morpholinyl)phenyl]- is a chemical compound characterized by its pyridazinone core, which is a bicyclic structure containing a pyridine ring fused to a hydrazine derivative. This compound features a morpholine group, a six-membered ring containing both oxygen and nitrogen, which is attached to a phenyl group. The presence of these functional groups suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to their ability to interact with biological targets. The compound may exhibit various biological activities, including anti-inflammatory or analgesic properties, depending on its specific molecular interactions. Its molecular structure contributes to its solubility, stability, and reactivity, which are critical for its performance in biological systems. Additionally, the compound's CAS number, 1105194-10-2, serves as a unique identifier for regulatory and research purposes, facilitating its study and application in various scientific fields.

Formula: C₁₄H₁₅N₃O₂

InChI: InChI=1S/C14H15N3O2/c18-14-6-5-13(15-16-14)11-1-3-12(4-2-11)17-7-9-19-10-8-17/h1-6H,7-10H2,(H,16,18)

InChI key: InChIKey=WFAXVXYIVHUOOB-UHFFFAOYSA-N

SMILES: O=C1C=CC(C2=CC=C(C=C2)N3CCOCC3)=NN1

Synonyms:

• 3(2H)-Pyridazinone, 6-[4-(4-morpholinyl)phenyl]-