CAS 1105194-24-8
:7-Chloro-4-methoxy-N-(2-pyridinylmethyl)-2-benzothiazolamine
Description:
7-Chloro-4-methoxy-N-(2-pyridinylmethyl)-2-benzothiazolamine is a chemical compound characterized by its complex structure, which includes a benzothiazole moiety, a chloro group, a methoxy group, and a pyridinylmethyl substituent. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the benzothiazole ring often contributes to its pharmacological properties, as benzothiazoles are known for their diverse biological activities, including antimicrobial and anticancer effects. The chloro and methoxy substituents can influence the compound's reactivity and interaction with biological targets. Additionally, the pyridinylmethyl group may enhance its ability to bind to specific receptors or enzymes, potentially increasing its therapeutic efficacy. Overall, this compound's unique structural features suggest it may have applications in drug development, particularly in targeting diseases where benzothiazole derivatives have shown promise.
Formula:C14H12ClN3OS
InChI:InChI=1S/C14H12ClN3OS/c1-19-11-6-5-10(15)13-12(11)18-14(20-13)17-8-9-4-2-3-7-16-9/h2-7H,8H2,1H3,(H,17,18)
InChI key:InChIKey=SQHGECOHPVJPKS-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(SC(NCC3=CC=CC=N3)=N2)=C(Cl)C=C1
Synonyms:- 7-Chloro-4-methoxy-N-(2-pyridinylmethyl)-2-benzothiazolamine
- 2-Benzothiazolamine, 7-chloro-4-methoxy-N-(2-pyridinylmethyl)-
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery