CymitQuimica logo

CAS 1105194-30-6

:

6-(1-Naphthalenyl)-3(2H)-pyridazinone

Description:
6-(1-Naphthalenyl)-3(2H)-pyridazinone, identified by its CAS number 1105194-30-6, is a chemical compound that features a pyridazinone core substituted with a naphthyl group. This compound typically exhibits characteristics common to heterocyclic compounds, including potential biological activity due to its structural features. The presence of the naphthyl moiety may contribute to its hydrophobic properties, influencing its solubility and interaction with biological membranes. Pyridazinones are known for their diverse pharmacological activities, which may include anti-inflammatory, antimicrobial, or anticancer properties. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions or cyclization processes. Additionally, its stability and reactivity can be influenced by the electronic effects of the naphthyl group. Overall, 6-(1-Naphthalenyl)-3(2H)-pyridazinone represents a class of compounds that could be of interest in medicinal chemistry and drug development, warranting further investigation into its specific properties and potential applications.
Formula:C14H10N2O
InChI:InChI=1S/C14H10N2O/c17-14-9-8-13(15-16-14)12-7-3-5-10-4-1-2-6-11(10)12/h1-9H,(H,16,17)
InChI key:InChIKey=ICAGUJCIYINNRR-UHFFFAOYSA-N
SMILES:O=C1C=CC(C=2C3=C(C=CC2)C=CC=C3)=NN1
Synonyms:
  • 6-(1-Naphthalenyl)-3(2H)-pyridazinone
  • 3-Naphthalen-1-yl-1H-pyridazin-6-one
  • 3(2H)-Pyridazinone, 6-(1-naphthalenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.