CAS 1105194-34-0
:6-(2,4-Dimethoxyphenyl)-3(2H)-pyridazinone
Description:
6-(2,4-Dimethoxyphenyl)-3(2H)-pyridazinone is a chemical compound characterized by its unique structure, which includes a pyridazinone core substituted with a 2,4-dimethoxyphenyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including potential biological activity due to its structural features. The presence of methoxy groups can enhance solubility and influence the compound's reactivity and interaction with biological targets. Pyridazinones are known for their diverse pharmacological properties, including anti-inflammatory and antimicrobial activities. The specific arrangement of substituents in 6-(2,4-Dimethoxyphenyl)-3(2H)-pyridazinone may contribute to its potential applications in medicinal chemistry. Additionally, the compound's stability, melting point, and solubility characteristics would depend on the specific conditions under which it is synthesized and stored. As with many organic compounds, safety data and handling precautions should be considered when working with this substance in a laboratory setting.
Formula:C12H12N2O3
InChI:InChI=1S/C12H12N2O3/c1-16-8-3-4-9(11(7-8)17-2)10-5-6-12(15)14-13-10/h3-7H,1-2H3,(H,14,15)
InChI key:InChIKey=LPEKJLCEPFJXNI-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(OC)=C1)C=2C=CC(=O)NN2
Synonyms:- 6-(2,4-Dimethoxyphenyl)-3(2H)-pyridazinone
- 3(2H)-Pyridazinone, 6-(2,4-dimethoxyphenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.