CAS 1105194-39-5
:N-Hydroxy-6-[3-(3-methyl-5-isoxazolyl)propoxy]-3-pyridinecarboximidamide
Description:
N-Hydroxy-6-[3-(3-methyl-5-isoxazolyl)propoxy]-3-pyridinecarboximidamide is a chemical compound characterized by its complex structure, which includes a pyridine ring, an isoxazole moiety, and a hydroxylamine functional group. This compound is typically classified as an organic molecule and may exhibit properties such as solubility in polar solvents due to the presence of hydroxyl and amide functionalities. Its molecular structure suggests potential biological activity, possibly as a pharmaceutical agent, given the presence of functional groups that can participate in hydrogen bonding and other interactions. The compound's specific reactivity and stability would depend on environmental conditions such as pH and temperature. Additionally, its synthesis and application may be of interest in medicinal chemistry, particularly in the development of drugs targeting specific biological pathways. As with many organic compounds, safety and handling precautions should be observed, especially in laboratory settings. Further studies would be necessary to fully elucidate its properties and potential applications.
Formula:C13H16N4O3
InChI:InChI=1S/C13H16N4O3/c1-9-7-11(20-17-9)3-2-6-19-12-5-4-10(8-15-12)13(14)16-18/h4-5,7-8,18H,2-3,6H2,1H3,(H2,14,16)
InChI key:InChIKey=VAGAMWTXYDQBDB-UHFFFAOYSA-N
SMILES:C(NO)(=N)C=1C=CC(OCCCC2=CC(C)=NO2)=NC1
Synonyms:- N-Hydroxy-6-[3-(3-methyl-5-isoxazolyl)propoxy]-3-pyridinecarboximidamide
- 3-Pyridinecarboximidamide, N-hydroxy-6-[3-(3-methyl-5-isoxazolyl)propoxy]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.