CAS 1105194-41-9

5-Methoxy-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine

Description:

5-Methoxy-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety and a methoxy group. The presence of the tetrahydro-2-furanyl group suggests that it may exhibit interesting reactivity and potential biological activity, possibly due to the furan ring's electron-rich nature. This compound is likely to be a solid at room temperature, given the stability of its aromatic and heterocyclic components. Its solubility may vary depending on the solvent, but it is expected to be more soluble in polar organic solvents due to the methoxy and amine functionalities. The benzothiazole structure is known for its applications in pharmaceuticals and agrochemicals, often exhibiting antimicrobial and anti-inflammatory properties. The specific interactions and potential applications of this compound would require further investigation, including studies on its pharmacokinetics and biological activity. Overall, 5-Methoxy-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine represents a compound of interest in medicinal chemistry and related fields.

Formula: C₁₃H₁₆N₂O₂S

InChI: InChI=1S/C13H16N2O2S/c1-16-9-4-5-12-11(7-9)15-13(18-12)14-8-10-3-2-6-17-10/h4-5,7,10H,2-3,6,8H2,1H3,(H,14,15)

InChI key: InChIKey=MXSHZSHSKRWVKT-UHFFFAOYSA-N

SMILES: N(CC1CCCO1)C=2SC=3C(N2)=CC(OC)=CC3

Synonyms:

• 2-Benzothiazolamine, 5-methoxy-N-[(tetrahydro-2-furanyl)methyl]-
• 5-Methoxy-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine