CAS 1105194-58-8

4-[4-(6-Chloro-3-pyridazinyl)phenyl]morpholine

Description:

4-[4-(6-Chloro-3-pyridazinyl)phenyl]morpholine, identified by its CAS number 1105194-58-8, is a chemical compound characterized by its unique structural features. It consists of a morpholine ring, which is a six-membered ring containing one nitrogen atom and five carbon atoms, linked to a phenyl group that is further substituted with a pyridazine moiety. The presence of a chlorine atom at the 6-position of the pyridazine ring contributes to its potential biological activity and lipophilicity. This compound may exhibit various pharmacological properties, making it of interest in medicinal chemistry and drug development. Its molecular structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. Additionally, the compound's solubility, stability, and reactivity can be influenced by the functional groups present, making it essential to consider these characteristics in practical applications. Overall, 4-[4-(6-Chloro-3-pyridazinyl)phenyl]morpholine represents a class of compounds that may hold significance in research and development within the pharmaceutical industry.

Formula: C₁₄H₁₄ClN₃O

InChI: InChI=1S/C14H14ClN3O/c15-14-6-5-13(16-17-14)11-1-3-12(4-2-11)18-7-9-19-10-8-18/h1-6H,7-10H2

InChI key: InChIKey=OXFVGCYLXFDJFT-UHFFFAOYSA-N

SMILES: ClC1=CC=C(C2=CC=C(C=C2)N3CCOCC3)N=N1

Synonyms:

• Morpholine, 4-[4-(6-chloro-3-pyridazinyl)phenyl]-
• 4-[4-(6-Chloro-3-pyridazinyl)phenyl]morpholine