CymitQuimica logo

CAS 1105194-62-4

:

3-Chloro-6-(2,3,4-trimethoxyphenyl)pyridazine

Description:
3-Chloro-6-(2,3,4-trimethoxyphenyl)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a 2,3,4-trimethoxyphenyl group at the 6-position contributes to its unique chemical properties. The trimethoxyphenyl substituent indicates that the compound has three methoxy (-OCH3) groups attached to a phenyl ring, enhancing its solubility and potentially influencing its reactivity and biological activity. This compound may exhibit interesting pharmacological properties due to its structural features, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The CAS number 1105194-62-4 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. As with many organic compounds, its stability, reactivity, and interactions with other substances would depend on various factors, including environmental conditions and the presence of functional groups.
Formula:C13H13ClN2O3
InChI:InChI=1S/C13H13ClN2O3/c1-17-10-6-4-8(12(18-2)13(10)19-3)9-5-7-11(14)16-15-9/h4-7H,1-3H3
InChI key:InChIKey=BOXAJPFLNGYDMQ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(OC)=C1OC)C2=CC=C(Cl)N=N2
Synonyms:
  • Pyridazine, 3-chloro-6-(2,3,4-trimethoxyphenyl)-
  • 3-Chloro-6-(2,3,4-trimethoxyphenyl)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.