CAS 1105194-69-1

6-Chloro-4-methyl-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine

Description:

6-Chloro-4-methyl-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine is a chemical compound characterized by its unique structural features, which include a benzothiazole moiety, a chloro substituent, and a tetrahydrofuran-derived side chain. The presence of the benzothiazole ring contributes to its potential biological activity, as this class of compounds is often associated with various pharmacological properties. The chloro group enhances the compound's reactivity and may influence its interaction with biological targets. The tetrahydrofuran ring adds to the compound's lipophilicity, potentially affecting its solubility and permeability in biological systems. This compound may be of interest in medicinal chemistry for its potential applications in drug development, particularly in targeting specific enzymes or receptors. Its synthesis and characterization would typically involve standard organic chemistry techniques, and its properties can be further explored through various analytical methods such as NMR, mass spectrometry, and chromatography. Overall, the compound's unique structure suggests a promising avenue for research in pharmacology and related fields.

Formula: C₁₃H₁₅ClN₂OS

InChI: InChI=1S/C13H15ClN2OS/c1-8-5-9(14)6-11-12(8)16-13(18-11)15-7-10-3-2-4-17-10/h5-6,10H,2-4,7H2,1H3,(H,15,16)

InChI key: InChIKey=PTUAVKAEKINLCT-UHFFFAOYSA-N

SMILES: CC1=C2C(SC(NCC3CCCO3)=N2)=CC(Cl)=C1

Synonyms:

• 6-Chloro-4-methyl-N-[(tetrahydro-2-furanyl)methyl]-2-benzothiazolamine
• 2-Benzothiazolamine, 6-chloro-4-methyl-N-[(tetrahydro-2-furanyl)methyl]-