CymitQuimica logo

CAS 1105194-86-2

:

3-Chloro-6-(4-fluoro-3-nitrophenyl)pyridazine

Description:
3-Chloro-6-(4-fluoro-3-nitrophenyl)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two adjacent nitrogen atoms. The presence of a chlorine atom at the 3-position and a 4-fluoro-3-nitrophenyl group at the 6-position contributes to its unique reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The fluorine and nitro substituents enhance the compound's electronic properties, potentially influencing its biological activity and solubility. This compound may exhibit interesting interactions due to the electron-withdrawing nature of the nitro group and the electronegative fluorine atom, which can affect its stability and reactivity. Additionally, the presence of multiple functional groups suggests that it could participate in various chemical reactions, making it a candidate for further research in synthetic chemistry. As with many halogenated and nitro-substituted compounds, safety and handling precautions are essential due to potential toxicity and environmental impact.
Formula:C10H5ClFN3O2
InChI:InChI=1S/C10H5ClFN3O2/c11-10-4-3-8(13-14-10)6-1-2-7(12)9(5-6)15(16)17/h1-5H
InChI key:InChIKey=TYHRIDVBXQATNR-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C=C(C=CC1F)C2=CC=C(Cl)N=N2
Synonyms:
  • Pyridazine, 3-chloro-6-(4-fluoro-3-nitrophenyl)-
  • 3-Chloro-6-(4-fluoro-3-nitrophenyl)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.