CymitQuimica logo

CAS 1105194-94-2

:

3-Chloro-6-(3-chloro-4-fluorophenyl)pyridazine

Description:
3-Chloro-6-(3-chloro-4-fluorophenyl)pyridazine is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of chlorine and fluorine substituents on the phenyl group enhances its reactivity and potential applications in pharmaceuticals or agrochemicals. The compound's structure suggests it may exhibit specific biological activities, possibly related to its halogenated aromatic nature, which can influence interactions with biological targets. Its molecular formula and weight, along with its solubility and stability under various conditions, would be essential for understanding its practical applications. Additionally, the compound's synthesis and characterization would typically involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its identity and purity. Safety data sheets would provide information on handling, storage, and potential hazards associated with this compound, emphasizing the importance of proper laboratory practices when working with halogenated organic substances.
Formula:C10H5Cl2FN2
InChI:InChI=1S/C10H5Cl2FN2/c11-7-5-6(1-2-8(7)13)9-3-4-10(12)15-14-9/h1-5H
InChI key:InChIKey=YTIABLSLZDHADY-UHFFFAOYSA-N
SMILES:ClC=1C=C(C=CC1F)C2=CC=C(Cl)N=N2
Synonyms:
  • 3-Chloro-6-(3-chloro-4-fluorophenyl)pyridazine
  • Pyridazine, 3-chloro-6-(3-chloro-4-fluorophenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.