CymitQuimica logo

CAS 1105194-98-6

:

3-Chloro-6-(5-methyl-2-thienyl)pyridazine

Description:
3-Chloro-6-(5-methyl-2-thienyl)pyridazine is a heterocyclic organic compound characterized by its pyridazine core, which is a six-membered ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a 5-methyl-2-thienyl group at the 6-position contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic thienyl group, which can influence its solubility and reactivity. The chlorine substituent may impart electrophilic characteristics, making it a potential candidate for further chemical modifications or reactions. Additionally, the thienyl group can participate in various interactions, such as π-π stacking and dipole-dipole interactions, which may affect its biological activity and potential applications in pharmaceuticals or agrochemicals. Overall, 3-Chloro-6-(5-methyl-2-thienyl)pyridazine represents a versatile structure with potential utility in synthetic chemistry and medicinal chemistry research.
Formula:C9H7ClN2S
InChI:InChI=1S/C9H7ClN2S/c1-6-2-4-8(13-6)7-3-5-9(10)12-11-7/h2-5H,1H3
InChI key:InChIKey=LFRIRVPPUDPRLH-UHFFFAOYSA-N
SMILES:CC=1SC(C2=CC=C(Cl)N=N2)=CC1
Synonyms:
  • Pyridazine, 3-chloro-6-(5-methyl-2-thienyl)-
  • 3-Chloro-6-(5-methyl-2-thienyl)pyridazine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.