CAS 1105195-02-5
:3-Chloro-6-(5-methyl-2-furanyl)pyridazine
Description:
3-Chloro-6-(5-methyl-2-furanyl)pyridazine is a heterocyclic organic compound characterized by the presence of a pyridazine ring, which is a six-membered ring containing two nitrogen atoms. The compound features a chlorine substituent at the 3-position and a 5-methyl-2-furanyl group at the 6-position, contributing to its unique chemical properties. The furan moiety, a five-membered aromatic ring containing one oxygen atom, enhances the compound's reactivity and potential for forming various derivatives. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structure suggests potential interactions with biological targets, which could lead to applications in pharmaceuticals. Additionally, the presence of chlorine can influence the compound's solubility and stability. As with many heterocycles, the electronic properties imparted by the nitrogen and chlorine atoms can affect its reactivity in chemical reactions, making it a subject of interest for further research in synthetic organic chemistry.
Formula:C9H7ClN2O
InChI:InChI=1S/C9H7ClN2O/c1-6-2-4-8(13-6)7-3-5-9(10)12-11-7/h2-5H,1H3
InChI key:InChIKey=VTLLRLIRPLSNNF-UHFFFAOYSA-N
SMILES:CC=1OC(C2=CC=C(Cl)N=N2)=CC1
Synonyms:- Pyridazine, 3-chloro-6-(5-methyl-2-furanyl)-
- 3-Chloro-6-(5-methyl-2-furanyl)pyridazine
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery