
CAS 1105195-03-6
:2-[[(2,5-Dimethylphenyl)methyl]thio]-4,5-dihydro-1H-imidazole
Description:
2-[[(2,5-Dimethylphenyl)methyl]thio]-4,5-dihydro-1H-imidazole is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a thioether group, specifically a methylthio group attached to a 2,5-dimethylphenyl moiety, contributes to its unique properties. This compound may exhibit moderate lipophilicity due to the aromatic ring and alkyl substituents, which can influence its solubility and interaction with biological systems. The imidazole ring is known for its role in various biological processes and can participate in hydrogen bonding, making it a potential candidate for pharmaceutical applications. Additionally, the presence of the dimethylphenyl group may enhance its stability and reactivity. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require experimental determination or detailed literature references for comprehensive characterization.
Formula:C12H16N2S
InChI:InChI=1S/C12H16N2S/c1-9-3-4-10(2)11(7-9)8-15-12-13-5-6-14-12/h3-4,7H,5-6,8H2,1-2H3,(H,13,14)
InChI key:InChIKey=GWRHOVMHAYUDGR-UHFFFAOYSA-N
SMILES:C(SC=1NCCN1)C2=C(C)C=CC(C)=C2
Synonyms:- 2-[[(2,5-Dimethylphenyl)methyl]thio]-4,5-dihydro-1H-imidazole
- 1H-Imidazole, 2-[[(2,5-dimethylphenyl)methyl]thio]-4,5-dihydro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.