CAS 1105195-18-3
:4-(6-Methoxy-3-pyridazinyl)benzenamine
Description:
4-(6-Methoxy-3-pyridazinyl)benzenamine is an organic compound characterized by its aromatic structure, which includes a benzenamine moiety and a pyridazine ring substituted with a methoxy group. The presence of the methoxy group enhances its solubility and may influence its reactivity and biological activity. This compound is likely to exhibit properties typical of amines, such as basicity and the ability to form hydrogen bonds, which can affect its interactions in biological systems. The pyridazine ring contributes to the compound's potential as a pharmacophore, making it of interest in medicinal chemistry for its possible applications in drug development. Additionally, the compound's molecular structure suggests it may participate in various chemical reactions, including electrophilic aromatic substitution and nucleophilic attacks, depending on the functional groups present. Its specific characteristics, such as melting point, boiling point, and solubility, would need to be determined experimentally or sourced from chemical databases for precise applications in research or industry.
Formula:C11H11N3O
InChI:InChI=1S/C11H11N3O/c1-15-11-7-6-10(13-14-11)8-2-4-9(12)5-3-8/h2-7H,12H2,1H3
InChI key:InChIKey=WAMQNXJKSCISIX-UHFFFAOYSA-N
SMILES:O(C)C1=CC=C(N=N1)C2=CC=C(N)C=C2
Synonyms:- 4-(6-Methoxy-3-pyridazinyl)benzenamine
- Benzenamine, 4-(6-methoxy-3-pyridazinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.