CAS 1105195-25-2
:3-Chloro-6-(2,4-dimethyl-5-thiazolyl)pyridazine
Description:
3-Chloro-6-(2,4-dimethyl-5-thiazolyl)pyridazine is a chemical compound characterized by its unique structural features, which include a pyridazine ring substituted with a chlorine atom and a thiazole moiety. The presence of the chlorine atom at the 3-position and the thiazole ring at the 6-position contributes to its potential reactivity and biological activity. This compound may exhibit properties typical of heterocyclic compounds, such as varied solubility in organic solvents and potential interactions with biological targets. The thiazole group, known for its role in various pharmacological activities, may enhance the compound's efficacy in medicinal chemistry. Additionally, the dimethyl substitutions on the thiazole ring can influence the compound's lipophilicity and overall stability. Due to these characteristics, 3-Chloro-6-(2,4-dimethyl-5-thiazolyl)pyridazine may be of interest in research fields such as drug development, agrochemicals, or materials science, although specific applications would depend on further studies and evaluations of its properties and activities.
Formula:C9H8ClN3S
InChI:InChI=1S/C9H8ClN3S/c1-5-9(14-6(2)11-5)7-3-4-8(10)13-12-7/h3-4H,1-2H3
InChI key:InChIKey=AOEASRKROYFFDN-UHFFFAOYSA-N
SMILES:CC1=C(SC(C)=N1)C2=CC=C(Cl)N=N2
Synonyms:- Pyridazine, 3-chloro-6-(2,4-dimethyl-5-thiazolyl)-
- 3-Chloro-6-(2,4-dimethyl-5-thiazolyl)pyridazine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.