CymitQuimica logo

CAS 1105195-28-5

:

6-(4-Methyl-2-phenyl-5-thiazolyl)-3(2H)-pyridazinone

Description:
6-(4-Methyl-2-phenyl-5-thiazolyl)-3(2H)-pyridazinone is a chemical compound characterized by its complex structure, which includes a pyridazinone core and a thiazole ring substituted with a phenyl group and a methyl group. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the thiazole and pyridazinone moieties suggests that it may interact with biological targets, potentially influencing various biochemical pathways. Its molecular structure may confer specific pharmacological properties, which could be explored in drug development. Additionally, the compound's stability and reactivity can be influenced by the functional groups present, impacting its synthesis and application in research. Overall, 6-(4-Methyl-2-phenyl-5-thiazolyl)-3(2H)-pyridazinone represents a class of compounds that may have significant implications in pharmaceutical chemistry and related fields.
Formula:C14H11N3OS
InChI:InChI=1S/C14H11N3OS/c1-9-13(11-7-8-12(18)17-16-11)19-14(15-9)10-5-3-2-4-6-10/h2-8H,1H3,(H,17,18)
InChI key:InChIKey=ZSBCDYJYLQPQRL-UHFFFAOYSA-N
SMILES:CC1=C(SC(=N1)C2=CC=CC=C2)C=3C=CC(=O)NN3
Synonyms:
  • 6-(4-Methyl-2-phenyl-5-thiazolyl)-3(2H)-pyridazinone
  • 3(2H)-Pyridazinone, 6-(4-methyl-2-phenyl-5-thiazolyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.