CAS 1105195-44-5

1-(3-Fluorophenyl)-5-oxo-3-pyrrolidinecarbonyl chloride

Description:

1-(3-Fluorophenyl)-5-oxo-3-pyrrolidinecarbonyl chloride is a chemical compound characterized by its unique structure, which includes a pyrrolidine ring and a carbonyl chloride functional group. The presence of the 3-fluorophenyl group indicates that it has a fluorine atom substituted on the phenyl ring, which can influence its reactivity and biological activity. This compound is likely to be a solid at room temperature, given the presence of the carbonyl chloride, which typically contributes to higher melting points. It may exhibit moderate to high reactivity due to the carbonyl chloride functional group, making it a potential intermediate in organic synthesis or pharmaceutical applications. The compound's molecular structure suggests it could participate in nucleophilic substitution reactions, particularly with amines or alcohols. Additionally, the fluorine atom may enhance lipophilicity and influence the compound's interaction with biological targets. Safety precautions should be taken when handling this compound, as carbonyl chlorides can be corrosive and harmful.

Formula: C₁₁H₉ClFNO₂

InChI: InChI=1S/C11H9ClFNO2/c12-11(16)7-4-10(15)14(6-7)9-3-1-2-8(13)5-9/h1-3,5,7H,4,6H2

InChI key: InChIKey=OTOXDWLCODITIJ-UHFFFAOYSA-N

SMILES: O=C1N(CC(C(Cl)=O)C1)C2=CC(F)=CC=C2

Synonyms:

• 1-(3-Fluorophenyl)-5-oxo-3-pyrrolidinecarbonyl chloride
• 3-Pyrrolidinecarbonyl chloride, 1-(3-fluorophenyl)-5-oxo-