CAS 1105195-48-9
:6-(2-Methoxyphenyl)-4(3H)-pyrimidinone
Description:
6-(2-Methoxyphenyl)-4(3H)-pyrimidinone, identified by its CAS number 1105195-48-9, is a chemical compound characterized by its pyrimidinone core structure, which features a methoxy-substituted phenyl group at the 6-position. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to its structural motifs. The presence of the methoxy group can influence its solubility and reactivity, making it a candidate for various applications in medicinal chemistry. Pyrimidinones are known for their role in pharmaceuticals, often acting as intermediates or active pharmaceutical ingredients. The compound may exhibit specific interactions with biological targets, which can be explored in drug development contexts. Additionally, its stability, melting point, and solubility characteristics would be relevant for practical applications, although these specific values would need to be determined experimentally. Overall, 6-(2-Methoxyphenyl)-4(3H)-pyrimidinone represents a class of compounds with potential utility in therapeutic applications.
Formula:C11H10N2O2
InChI:InChI=1S/C11H10N2O2/c1-15-10-5-3-2-4-8(10)9-6-11(14)13-7-12-9/h2-7H,1H3,(H,12,13,14)
InChI key:InChIKey=FBIIBEODPZRTLJ-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC=C1)C2=CC(=O)N=CN2
Synonyms:- 4(3H)-Pyrimidinone, 6-(2-methoxyphenyl)-
- 6-(2-Methoxyphenyl)-4(3H)-pyrimidinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.