CymitQuimica logo

CAS 1105195-73-0

:

3-(3-Aminopropyl)-1,2,3,4,5,6-hexahydro-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one

Description:
3-(3-Aminopropyl)-1,2,3,4,5,6-hexahydro-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one is a complex organic compound characterized by its unique bicyclic structure, which incorporates both a pyridine and diazocine moiety. This compound features a hexahydro framework, indicating it is saturated and contains multiple carbon atoms arranged in a cyclic manner. The presence of an amino group (3-aminopropyl) suggests potential for hydrogen bonding and reactivity, making it of interest in medicinal chemistry and drug development. The compound's structure may confer specific biological activities, possibly influencing its pharmacological properties. Additionally, the presence of nitrogen atoms in the diazocine ring can affect its electronic properties and reactivity. As with many organic compounds, its solubility, stability, and reactivity will depend on the surrounding environment, including pH and solvent conditions. Overall, this compound's intricate structure and functional groups make it a subject of interest for further research in various chemical and biological applications.
Formula:C14H21N3O
InChI:InChI=1S/C14H21N3O/c15-5-2-6-16-8-11-7-12(10-16)13-3-1-4-14(18)17(13)9-11/h1,3-4,11-12H,2,5-10,15H2
InChI key:InChIKey=QKNHBHAWXBIPFZ-UHFFFAOYSA-N
SMILES:C(CCN)N1CC2C=3N(CC(C2)C1)C(=O)C=CC3
Synonyms:
  • 3-(3-Aminopropyl)-1,2,3,4,5,6-hexahydro-1,5-methano-8H-pyrido[1,2-a][1,5]diazocin-8-one
  • 1,5-Methano-8H-pyrido[1,2-a][1,5]diazocin-8-one, 3-(3-aminopropyl)-1,2,3,4,5,6-hexahydro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.