CAS 11052-01-0
:ericamycin
Description:
Ericamycin is a naturally occurring antibiotic that belongs to the class of compounds known as macrolides. It is produced by the fermentation of certain strains of the bacterium Streptomyces. Characteristically, ericamycin exhibits a broad spectrum of antibacterial activity, particularly against Gram-positive bacteria, making it valuable in clinical settings for treating various infections. The compound is known for its complex molecular structure, which includes a large lactone ring and several functional groups that contribute to its biological activity. Ericamycin's mechanism of action primarily involves the inhibition of protein synthesis by binding to the bacterial ribosome, thereby preventing the translation of mRNA into proteins. Additionally, it has been studied for its potential immunosuppressive properties, which may have implications in transplant medicine. However, like many antibiotics, the emergence of resistance poses a challenge to its efficacy, necessitating ongoing research into its pharmacological properties and potential therapeutic applications.
Formula:C28H21NO8
InChI:InChI=1/C28H21NO8/c1-9-4-5-12-19(21(9)30)23(32)14-8-15-18(26(35)20(14)22(12)31)17-13(24(33)27(15)37-3)7-11-6-10(2)29-28(36)16(11)25(17)34/h4-8,24,27,30,33-35H,1-3H3,(H,29,36)/t24-,27-/m0/s1
Synonyms:- Naphthaceno[2,1-g]isoquinoline-1,9,14(2H)-trione, 6,7-dihydro-6,10,15,16-tetrahydroxy-7-methoxy-3,11-dimethyl-, (6S,7S)-
- Ericamycin
- Eriamycin
- ericamycin
- (6S,7S)-6,10,15,16-tetrahydroxy-7-methoxy-3,11-dimethyl-6,7-dihydrotetraceno[2,1-g]isoquinoline-1,9,14(2H)-trione
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Ericamycin
CAS:<p>Ericamycin is an antibiotic with antibacterial activity against Gram-positive bacteria. It effectively inhibits Staphylococcus aureus, with a minimum inhibitory concentration (MIC) ranging from 0.004 to 0.016 µg/mL.</p>Formula:C28H21NO8Color and Shape:SolidMolecular weight:499.468
