CAS 11052-32-7

Holothurin B

Description:

Holothurin B is a bioactive compound derived from certain species of sea cucumbers, particularly those belonging to the Holothuroidea class. It is classified as a saponin, which is characterized by its surfactant properties and ability to form stable foams in aqueous solutions. Holothurin B exhibits a complex molecular structure, typically featuring a steroid-like backbone with sugar moieties attached, contributing to its biological activity. This compound is known for its potential pharmacological effects, including cytotoxicity against various cancer cell lines, antimicrobial properties, and immunomodulatory effects. Additionally, Holothurin B has been studied for its role in traditional medicine and its potential applications in drug development. Its unique properties make it a subject of interest in both biochemical research and pharmaceutical applications. However, like many natural products, its efficacy and safety profile require thorough investigation through clinical studies to fully understand its therapeutic potential and mechanisms of action.

Formula: C₄₁H₆₄O₁₇S·Na

InChI: InChI=1S/C41H64O17S.Na/c1-19-27(43)29(45)30(46)32(53-19)55-31-28(44)22(58-59(49,50)51)18-52-33(31)54-25-12-14-37(6)21-17-24(42)41-34(47)57-39(8,26-11-13-35(2,3)56-26)40(41,48)16-15-38(41,7)20(21)9-10-23(37)36(25,4)5;/h17,19-20,22-33,42-46,48H,9-16,18H2,1-8H3,(H,49,50,51);

InChI key: InChIKey=MBASXDMKDCTMEM-UHFFFAOYSA-N

SMILES: OC12C3(C(C)(C4C(=CC3O)C5(C)C(CC4)C(C)(C)C(OC6C(OC7C(O)C(O)C(O)C(C)O7)C(O)C(OS(=O)(=O)O)CO6)CC5)CC1)C(=O)OC2(C)C8CCC(C)(C)O8.[Na]

Synonyms:

• Lanost-9(11)-en-18-oic acid, 3-[[2-O-(6-deoxy-β-D-glucopyranosyl)-4-O-sulfo-β-D-xylopyranosyl]oxy]-22,25-epoxy-12,17,20-trihydroxy-, γ-lactone, monosodium salt, (3β,12α,22S)-
• Lanost-9(11)-en-18-oic acid, 3-[[2-O-(6-deoxy-β-D-glucopyranosyl)-4-O-sulfo-β-D-xylopyranosyl]oxy]-22,25-epoxy-12,17,20-trihydroxy-, γ-lactone, sodium salt (1:1), (3β,12α,22S)-
• Holothurin B

Holothurin B

CAS: 11052-32-7

Holothurin B, as a part of a group of toxins, is originally isolated from the sea cucumber Actinopyga agassizi.

Formula: C₄₁H₆₄NaO₁₇S

Color and Shape: Solid

Molecular weight: 884.0

Ref: TM-T32094